C17H22NO4- — CID 7130706
(2S,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 7130706) has the molecular formula C17H22NO4- and a molecular weight of 304.37 g/mol. Its IUPAC name is (2S,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | (2S,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 7130706 |
| Molecular Formula | C17H22NO4- |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2S,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | CCCCN1C(=O)CC[C@H](C(=O)[O-])[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C17H23NO4/c1-3-4-11-18-15(19)10-9-13(17(20)21)16(18)12-7-5-6-8-14(12)22-2/h5-8,13,16H,3-4,9-11H2,1-2H3,(H,20,21)/p-1/t13-,16+/m0/s1 |
| InChIKey | FZWVAHBTTMGQTE-XJKSGUPXSA-M |
| XLogP | 1.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |