About (2,4-dimethylphenyl)boronic acid;formaldehyde
(2,4-dimethylphenyl)boronic acid;formaldehyde (PubChem CID 71307086) has the molecular formula C9H13BO3
and a molecular weight of 180.01 g/mol. Its IUPAC name is (2,4-dimethylphenyl)boronic acid;formaldehyde.
Molecular Properties
| Compound Name | (2,4-dimethylphenyl)boronic acid;formaldehyde |
| PubChem CID | 71307086 |
| Molecular Formula | C9H13BO3 |
| Molecular Weight | 180.01 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2,4-dimethylphenyl)boronic acid;formaldehyde |
| SMILES | C=O.Cc1ccc(B(O)O)c(C)c1 |
| InChI | InChI=1S/C8H11BO2.CH2O/c1-6-3-4-8(9(10)11)7(2)5-6;1-2/h3-5,10-11H,1-2H3;1H2 |
| InChIKey | SRBPEJPJULWMMT-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.01 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethylphenyl)boronic acid;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylphenyl)boronic acid;formaldehyde?
The IUPAC name of (2,4-dimethylphenyl)boronic acid;formaldehyde (CID 71307086) is (2,4-dimethylphenyl)boronic acid;formaldehyde.
What is the SMILES notation for (2,4-dimethylphenyl)boronic acid;formaldehyde?
The canonical SMILES for (2,4-dimethylphenyl)boronic acid;formaldehyde is C=O.Cc1ccc(B(O)O)c(C)c1.
What is the InChIKey of (2,4-dimethylphenyl)boronic acid;formaldehyde?
The InChIKey is SRBPEJPJULWMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BO2.CH2O/c1-6-3-4-8(9(10)11)7(2)5-6;1-2/h3-5,10-11H,1-2H3;1H2.
What are the key properties of (2,4-dimethylphenyl)boronic acid;formaldehyde?
(2,4-dimethylphenyl)boronic acid;formaldehyde has a molecular weight of 180.01 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylphenyl)boronic acid;formaldehyde is sourced from PubChem (CID 71307086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).