C8H8Cl2N2O3S — CID 7130727
4,5-dichloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one (PubChem CID 7130727) has the molecular formula C8H8Cl2N2O3S and a molecular weight of 283.14 g/mol. Its IUPAC name is 4,5-dichloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 7130727 |
| Molecular Formula | C8H8Cl2N2O3S |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 4,5-dichloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H8Cl2N2O3S/c9-6-3-11-12(8(13)7(6)10)5-1-2-16(14,15)4-5/h3,5H,1-2,4H2/t5-/m1/s1 |
| InChIKey | OMIAKVZCMUVOLP-RXMQYKEDSA-N |
| XLogP | 0.91 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |