About 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine
3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine (PubChem CID 71307611) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine.
Analyze 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine?
The IUPAC name of 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine (CID 71307611) is 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine is Cc1[nH]nc2c1CCNC2.
What is the InChIKey of 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine?
The InChIKey is VCPPHXQSXGPMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5-6-2-3-8-4-7(6)10-9-5/h8H,2-4H2,1H3,(H,9,10).
What are the key properties of 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine?
3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine has a molecular weight of 137.19 g/mol, XLogP of 0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 71307611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).