About (4-iodo-1,3-dimethylpyrazol-5-yl)methanol
(4-iodo-1,3-dimethylpyrazol-5-yl)methanol (PubChem CID 71307692) has the molecular formula C6H9IN2O
and a molecular weight of 252.05 g/mol. Its IUPAC name is (4-iodo-1,3-dimethylpyrazol-5-yl)methanol.
Molecular Properties
| Compound Name | (4-iodo-1,3-dimethylpyrazol-5-yl)methanol |
| PubChem CID | 71307692 |
| Molecular Formula | C6H9IN2O |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | (4-iodo-1,3-dimethylpyrazol-5-yl)methanol |
| SMILES | Cc1nn(C)c(CO)c1I |
| InChI | InChI=1S/C6H9IN2O/c1-4-6(7)5(3-10)9(2)8-4/h10H,3H2,1-2H3 |
| InChIKey | FBUYLCVUXNTMHH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-iodo-1,3-dimethylpyrazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodo-1,3-dimethylpyrazol-5-yl)methanol?
The IUPAC name of (4-iodo-1,3-dimethylpyrazol-5-yl)methanol (CID 71307692) is (4-iodo-1,3-dimethylpyrazol-5-yl)methanol.
What is the SMILES notation for (4-iodo-1,3-dimethylpyrazol-5-yl)methanol?
The canonical SMILES for (4-iodo-1,3-dimethylpyrazol-5-yl)methanol is Cc1nn(C)c(CO)c1I.
What is the InChIKey of (4-iodo-1,3-dimethylpyrazol-5-yl)methanol?
The InChIKey is FBUYLCVUXNTMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2O/c1-4-6(7)5(3-10)9(2)8-4/h10H,3H2,1-2H3.
What are the key properties of (4-iodo-1,3-dimethylpyrazol-5-yl)methanol?
(4-iodo-1,3-dimethylpyrazol-5-yl)methanol has a molecular weight of 252.05 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodo-1,3-dimethylpyrazol-5-yl)methanol is sourced from PubChem (CID 71307692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).