C19H21ClN4 — CID 71307835
3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 71307835) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 71307835 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | Cc1cc(-c2nnc3n2CCCCC3)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN4/c1-13-12-17(14(2)24(13)16-9-7-15(20)8-10-16)19-22-21-18-6-4-3-5-11-23(18)19/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | ABOHKJIFAQARLX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|