C21H26N4 — CID 71307844
3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[4,3-a]azonine (PubChem CID 71307844) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[4,3-a]azonine.
| Compound Name | 3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[4,3-a]azonine |
|---|---|
| PubChem CID | 71307844 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[4,3-a]azonine |
| SMILES | Cc1cc(-c2nnc3n2CCCCCCC3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H26N4/c1-16-15-19(17(2)25(16)18-11-7-6-8-12-18)21-23-22-20-13-9-4-3-5-10-14-24(20)21/h6-8,11-12,15H,3-5,9-10,13-14H2,1-2H3 |
| InChIKey | QIXVBFXXNVSMEI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|