C18H25NO7S — CID 71308491
[(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]azanium;4-methylbenzenesulfonate (PubChem CID 71308491) has the molecular formula C18H25NO7S and a molecular weight of 399.47 g/mol. Its IUPAC name is [(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]azanium;4-methylbenzenesulfonate.
| Compound Name | [(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71308491 |
| Molecular Formula | C18H25NO7S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]azanium;4-methylbenzenesulfonate |
| SMILES | C=CCOC(=O)CC[C@H]([NH3+])C(=O)OCC=C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H17NO4.C7H8O3S/c1-3-7-15-10(13)6-5-9(12)11(14)16-8-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,9H,1-2,5-8,12H2;2-5H,1H3,(H,8,9,10)/t9-;/m0./s1 |
| InChIKey | CXIWDQLHGWDUTO-FVGYRXGTSA-N |
| XLogP | 0.73 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|