C10H9N — CID 71308815
2,3,4,5,6,7,8-heptadeuterionaphthalen-1-amine (PubChem CID 71308815) has the molecular formula C10H9N and a molecular weight of 150.23 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterionaphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterionaphthalen-1-amine |
|---|---|
| PubChem CID | 71308815 |
| Molecular Formula | C10H9N |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterionaphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(N)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2/i1D,2D,3D,4D,5D,6D,7D |
| InChIKey | RUFPHBVGCFYCNW-GSNKEKJESA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|