About 2-methoxy-2-(113C)methyl(1,4-13C2)butane
2-methoxy-2-(113C)methyl(1,4-13C2)butane (PubChem CID 71308924) has the molecular formula C6H14O
and a molecular weight of 105.15 g/mol. Its IUPAC name is 2-methoxy-2-(113C)methyl(1,4-13C2)butane.
Molecular Properties
| Compound Name | 2-methoxy-2-(113C)methyl(1,4-13C2)butane |
| PubChem CID | 71308924 |
| Molecular Formula | C6H14O |
| Molecular Weight | 105.15 g/mol |
| Exact Mass | 105.11 |
| IUPAC Name | 2-methoxy-2-(113C)methyl(1,4-13C2)butane |
| SMILES | COC([13CH3])([13CH3])C[13CH3] |
| InChI | InChI=1S/C6H14O/c1-5-6(2,3)7-4/h5H2,1-4H3/i1+1,2+1,3+1 |
| InChIKey | HVZJRWJGKQPSFL-VMIGTVKRSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxy-2-(113C)methyl(1,4-13C2)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-(113C)methyl(1,4-13C2)butane?
The IUPAC name of 2-methoxy-2-(113C)methyl(1,4-13C2)butane (CID 71308924) is 2-methoxy-2-(113C)methyl(1,4-13C2)butane.
What is the SMILES notation for 2-methoxy-2-(113C)methyl(1,4-13C2)butane?
The canonical SMILES for 2-methoxy-2-(113C)methyl(1,4-13C2)butane is COC([13CH3])([13CH3])C[13CH3].
What is the InChIKey of 2-methoxy-2-(113C)methyl(1,4-13C2)butane?
The InChIKey is HVZJRWJGKQPSFL-VMIGTVKRSA-N. The full InChI is InChI=1S/C6H14O/c1-5-6(2,3)7-4/h5H2,1-4H3/i1+1,2+1,3+1.
What are the key properties of 2-methoxy-2-(113C)methyl(1,4-13C2)butane?
2-methoxy-2-(113C)methyl(1,4-13C2)butane has a molecular weight of 105.15 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-(113C)methyl(1,4-13C2)butane is sourced from PubChem (CID 71308924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).