2,2-dideuterio-2-(diaminomethylideneamino)acetic acid

C3H7N3O2 — CID 71309039

IUPAC2,2-dideuterio-2-(diaminomethylideneamino)acetic acid
SMILES[2H]C([2H])(N=C(N)N)C(=O)O
InChIInChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6)/i1D2
InChIKeyBPMFZUMJYQTVII-DICFDUPASA-N
MW119.12 g/mol
LogP-1.66
Rot. Bonds2

About 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid

2,2-dideuterio-2-(diaminomethylideneamino)acetic acid (PubChem CID 71309039) has the molecular formula C3H7N3O2 and a molecular weight of 119.12 g/mol. Its IUPAC name is 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid.

Molecular Properties

Compound Name2,2-dideuterio-2-(diaminomethylideneamino)acetic acid
PubChem CID71309039
Molecular FormulaC3H7N3O2
Molecular Weight119.12 g/mol
Exact Mass119.07
IUPAC Name2,2-dideuterio-2-(diaminomethylideneamino)acetic acid
SMILES[2H]C([2H])(N=C(N)N)C(=O)O
InChIInChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6)/i1D2
InChIKeyBPMFZUMJYQTVII-DICFDUPASA-N
XLogP-1.66
TPSA101.70 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500119.12
LogP ≤ 5-1.66
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid?
The IUPAC name of 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid (CID 71309039) is 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid.
What is the SMILES notation for 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid?
The canonical SMILES for 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid is [2H]C([2H])(N=C(N)N)C(=O)O.
What is the InChIKey of 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid?
The InChIKey is BPMFZUMJYQTVII-DICFDUPASA-N. The full InChI is InChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6)/i1D2.
What are the key properties of 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid?
2,2-dideuterio-2-(diaminomethylideneamino)acetic acid has a molecular weight of 119.12 g/mol, XLogP of -1.66, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dideuterio-2-(diaminomethylideneamino)acetic acid is sourced from PubChem (CID 71309039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).