About (1,2,3,4-13C4)butane
(1,2,3,4-13C4)butane (PubChem CID 71309065) has the molecular formula C4H10
and a molecular weight of 62.09 g/mol. Its IUPAC name is (1,2,3,4-13C4)butane.
Molecular Properties
| Compound Name | (1,2,3,4-13C4)butane |
| PubChem CID | 71309065 |
| Molecular Formula | C4H10 |
| Molecular Weight | 62.09 g/mol |
| Exact Mass | 62.09 |
| IUPAC Name | (1,2,3,4-13C4)butane |
| SMILES | [13CH3][13CH2][13CH2][13CH3] |
| InChI | InChI=1S/C4H10/c1-3-4-2/h3-4H2,1-2H3/i1+1,2+1,3+1,4+1 |
| InChIKey | IJDNQMDRQITEOD-JCDJMFQYSA-N |
| XLogP | 1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 62.09 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1,2,3,4-13C4)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2,3,4-13C4)butane?
The IUPAC name of (1,2,3,4-13C4)butane (CID 71309065) is (1,2,3,4-13C4)butane.
What is the SMILES notation for (1,2,3,4-13C4)butane?
The canonical SMILES for (1,2,3,4-13C4)butane is [13CH3][13CH2][13CH2][13CH3].
What is the InChIKey of (1,2,3,4-13C4)butane?
The InChIKey is IJDNQMDRQITEOD-JCDJMFQYSA-N. The full InChI is InChI=1S/C4H10/c1-3-4-2/h3-4H2,1-2H3/i1+1,2+1,3+1,4+1.
What are the key properties of (1,2,3,4-13C4)butane?
(1,2,3,4-13C4)butane has a molecular weight of 62.09 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2,3,4-13C4)butane is sourced from PubChem (CID 71309065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).