C4H10O2 — CID 71309106
(1,2,3,4-13C4)butane-1,4-diol (PubChem CID 71309106) has the molecular formula C4H10O2 and a molecular weight of 94.09 g/mol. Its IUPAC name is (1,2,3,4-13C4)butane-1,4-diol.
| Compound Name | (1,2,3,4-13C4)butane-1,4-diol |
|---|---|
| PubChem CID | 71309106 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 94.09 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | (1,2,3,4-13C4)butane-1,4-diol |
| SMILES | O[13CH2][13CH2][13CH2][13CH2]O |
| InChI | InChI=1S/C4H10O2/c5-3-1-2-4-6/h5-6H,1-4H2/i1+1,2+1,3+1,4+1 |
| InChIKey | WERYXYBDKMZEQL-JCDJMFQYSA-N |
| XLogP | -0.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.09 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|