C12H26 — CID 71309250
(1,2,3,4,5,6,7,8,9,10,11,12-13C12)dodecane (PubChem CID 71309250) has the molecular formula C12H26 and a molecular weight of 182.25 g/mol. Its IUPAC name is (1,2,3,4,5,6,7,8,9,10,11,12-13C12)dodecane.
| Compound Name | (1,2,3,4,5,6,7,8,9,10,11,12-13C12)dodecane |
|---|---|
| PubChem CID | 71309250 |
| Molecular Formula | C12H26 |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.24 |
| IUPAC Name | (1,2,3,4,5,6,7,8,9,10,11,12-13C12)dodecane |
| SMILES | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH3] |
| InChI | InChI=1S/C12H26/c1-3-5-7-9-11-12-10-8-6-4-2/h3-12H2,1-2H3/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1 |
| InChIKey | SNRUBQQJIBEYMU-WCGVKTIYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|