C3H6Cl2 — CID 71309283
1,2-dichloro(1,2,3-13C3)propane (PubChem CID 71309283) has the molecular formula C3H6Cl2 and a molecular weight of 115.96 g/mol. Its IUPAC name is 1,2-dichloro(1,2,3-13C3)propane.
| Compound Name | 1,2-dichloro(1,2,3-13C3)propane |
|---|---|
| PubChem CID | 71309283 |
| Molecular Formula | C3H6Cl2 |
| Molecular Weight | 115.96 g/mol |
| Exact Mass | 114.99 |
| IUPAC Name | 1,2-dichloro(1,2,3-13C3)propane |
| SMILES | [13CH3][13CH](Cl)[13CH2]Cl |
| InChI | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3/i1+1,2+1,3+1 |
| InChIKey | KNKRKFALVUDBJE-VMIGTVKRSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.96 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|