About ethyl 2-oxo(313C)propanoate
ethyl 2-oxo(313C)propanoate (PubChem CID 71309388) has the molecular formula C5H8O3
and a molecular weight of 117.11 g/mol. Its IUPAC name is ethyl 2-oxo(313C)propanoate.
Molecular Properties
| Compound Name | ethyl 2-oxo(313C)propanoate |
| PubChem CID | 71309388 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 117.11 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | ethyl 2-oxo(313C)propanoate |
| SMILES | CCOC(=O)C([13CH3])=O |
| InChI | InChI=1S/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3/i2+1 |
| InChIKey | XXRCUYVCPSWGCC-VQEHIDDOSA-N |
| XLogP | 0.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.11 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxo(313C)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxo(313C)propanoate?
The IUPAC name of ethyl 2-oxo(313C)propanoate (CID 71309388) is ethyl 2-oxo(313C)propanoate.
What is the SMILES notation for ethyl 2-oxo(313C)propanoate?
The canonical SMILES for ethyl 2-oxo(313C)propanoate is CCOC(=O)C([13CH3])=O.
What is the InChIKey of ethyl 2-oxo(313C)propanoate?
The InChIKey is XXRCUYVCPSWGCC-VQEHIDDOSA-N. The full InChI is InChI=1S/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3/i2+1.
What are the key properties of ethyl 2-oxo(313C)propanoate?
ethyl 2-oxo(313C)propanoate has a molecular weight of 117.11 g/mol, XLogP of 0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo(313C)propanoate is sourced from PubChem (CID 71309388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).