C3H6N6 — CID 71309406
(2,4,6-13C3)1,3,5-triazine-2,4,6-triamine (PubChem CID 71309406) has the molecular formula C3H6N6 and a molecular weight of 129.10 g/mol. Its IUPAC name is (2,4,6-13C3)1,3,5-triazine-2,4,6-triamine.
| Compound Name | (2,4,6-13C3)1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 71309406 |
| Molecular Formula | C3H6N6 |
| Molecular Weight | 129.10 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (2,4,6-13C3)1,3,5-triazine-2,4,6-triamine |
| SMILES | N[13c]1n[13c](N)n[13c](N)n1 |
| InChI | InChI=1S/C3H6N6/c4-1-7-2(5)9-3(6)8-1/h(H6,4,5,6,7,8,9)/i1+1,2+1,3+1 |
| InChIKey | JDSHMPZPIAZGSV-VMIGTVKRSA-N |
| XLogP | -1.38 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.10 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |