C4H8O — CID 71309418
1,1,3,3,3-pentadeuterio-2-(trideuteriomethoxy)prop-1-ene (PubChem CID 71309418) has the molecular formula C4H8O and a molecular weight of 80.16 g/mol. Its IUPAC name is 1,1,3,3,3-pentadeuterio-2-(trideuteriomethoxy)prop-1-ene.
| Compound Name | 1,1,3,3,3-pentadeuterio-2-(trideuteriomethoxy)prop-1-ene |
|---|---|
| PubChem CID | 71309418 |
| Molecular Formula | C4H8O |
| Molecular Weight | 80.16 g/mol |
| Exact Mass | 80.11 |
| IUPAC Name | 1,1,3,3,3-pentadeuterio-2-(trideuteriomethoxy)prop-1-ene |
| SMILES | [2H]C([2H])=C(OC([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H8O/c1-4(2)5-3/h1H2,2-3H3/i1D2,2D3,3D3 |
| InChIKey | YOWQWFMSQCOSBA-MGGKGRBPSA-N |
| XLogP | 1.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 80.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|