About (1,3-13C2)propan-2-ol
(1,3-13C2)propan-2-ol (PubChem CID 71309419) has the molecular formula C3H8O
and a molecular weight of 62.08 g/mol. Its IUPAC name is (1,3-13C2)propan-2-ol.
Molecular Properties
| Compound Name | (1,3-13C2)propan-2-ol |
| PubChem CID | 71309419 |
| Molecular Formula | C3H8O |
| Molecular Weight | 62.08 g/mol |
| Exact Mass | 62.06 |
| IUPAC Name | (1,3-13C2)propan-2-ol |
| SMILES | [13CH3]C([13CH3])O |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1+1,2+1 |
| InChIKey | KFZMGEQAYNKOFK-ZDOIIHCHSA-N |
| XLogP | 0.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 62.08 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1,3-13C2)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-13C2)propan-2-ol?
The IUPAC name of (1,3-13C2)propan-2-ol (CID 71309419) is (1,3-13C2)propan-2-ol.
What is the SMILES notation for (1,3-13C2)propan-2-ol?
The canonical SMILES for (1,3-13C2)propan-2-ol is [13CH3]C([13CH3])O.
What is the InChIKey of (1,3-13C2)propan-2-ol?
The InChIKey is KFZMGEQAYNKOFK-ZDOIIHCHSA-N. The full InChI is InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1+1,2+1.
What are the key properties of (1,3-13C2)propan-2-ol?
(1,3-13C2)propan-2-ol has a molecular weight of 62.08 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-13C2)propan-2-ol is sourced from PubChem (CID 71309419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).