About 2-amino-1,1-dideuteriobutan-1-ol
2-amino-1,1-dideuteriobutan-1-ol (PubChem CID 71309476) has the molecular formula C4H11NO
and a molecular weight of 91.15 g/mol. Its IUPAC name is 2-amino-1,1-dideuteriobutan-1-ol.
Molecular Properties
| Compound Name | 2-amino-1,1-dideuteriobutan-1-ol |
| PubChem CID | 71309476 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 91.15 g/mol |
| Exact Mass | 91.10 |
| IUPAC Name | 2-amino-1,1-dideuteriobutan-1-ol |
| SMILES | [2H]C([2H])(O)C(N)CC |
| InChI | InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/i3D2 |
| InChIKey | JCBPETKZIGVZRE-SMZGMGDZSA-N |
| XLogP | -0.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1,1-dideuteriobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,1-dideuteriobutan-1-ol?
The IUPAC name of 2-amino-1,1-dideuteriobutan-1-ol (CID 71309476) is 2-amino-1,1-dideuteriobutan-1-ol.
What is the SMILES notation for 2-amino-1,1-dideuteriobutan-1-ol?
The canonical SMILES for 2-amino-1,1-dideuteriobutan-1-ol is [2H]C([2H])(O)C(N)CC.
What is the InChIKey of 2-amino-1,1-dideuteriobutan-1-ol?
The InChIKey is JCBPETKZIGVZRE-SMZGMGDZSA-N. The full InChI is InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/i3D2.
What are the key properties of 2-amino-1,1-dideuteriobutan-1-ol?
2-amino-1,1-dideuteriobutan-1-ol has a molecular weight of 91.15 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,1-dideuteriobutan-1-ol is sourced from PubChem (CID 71309476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).