C3H4N2 — CID 71309634
1,3,4,5-tetradeuteriopyrazole (PubChem CID 71309634) has the molecular formula C3H4N2 and a molecular weight of 72.10 g/mol. Its IUPAC name is 1,3,4,5-tetradeuteriopyrazole.
| Compound Name | 1,3,4,5-tetradeuteriopyrazole |
|---|---|
| PubChem CID | 71309634 |
| Molecular Formula | C3H4N2 |
| Molecular Weight | 72.10 g/mol |
| Exact Mass | 72.06 |
| IUPAC Name | 1,3,4,5-tetradeuteriopyrazole |
| SMILES | [2H]c1nn([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5)/i1D,2D,3D/hD |
| InChIKey | WTKZEGDFNFYCGP-MSWVZFBTSA-N |
| XLogP | 0.41 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 72.10 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |