C4H8O2 — CID 71309681
(2,3,5,6-13C4)1,4-dioxane (PubChem CID 71309681) has the molecular formula C4H8O2 and a molecular weight of 92.08 g/mol. Its IUPAC name is (2,3,5,6-13C4)1,4-dioxane.
| Compound Name | (2,3,5,6-13C4)1,4-dioxane |
|---|---|
| PubChem CID | 71309681 |
| Molecular Formula | C4H8O2 |
| Molecular Weight | 92.08 g/mol |
| Exact Mass | 92.07 |
| IUPAC Name | (2,3,5,6-13C4)1,4-dioxane |
| SMILES | [13CH2]1[13CH2]O[13CH2][13CH2]O1 |
| InChI | InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2/i1+1,2+1,3+1,4+1 |
| InChIKey | RYHBNJHYFVUHQT-JCDJMFQYSA-N |
| XLogP | 0.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.08 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |