C6H5NO4 — CID 71309692
2-hydroxy-6-oxo-(2,3,4,5,6-13C5)1H-pyridine-4-carboxylic acid (PubChem CID 71309692) has the molecular formula C6H5NO4 and a molecular weight of 161.06 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-(2,3,4,5,6-13C5)1H-pyridine-4-carboxylic acid.
| Compound Name | 2-hydroxy-6-oxo-(2,3,4,5,6-13C5)1H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 71309692 |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 161.06 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 2-hydroxy-6-oxo-(2,3,4,5,6-13C5)1H-pyridine-4-carboxylic acid |
| SMILES | O=[13C](O)[13c]1[13cH][13c](O)[nH][13c](=O)[13cH]1 |
| InChI | InChI=1S/C6H5NO4/c8-4-1-3(6(10)11)2-5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | CSGQJHQYWJLPKY-IDEBNGHGSA-N |
| XLogP | -0.22 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.06 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |