C4H10O — CID 71309697
(1,2,3,4-13C4)butan-1-ol (PubChem CID 71309697) has the molecular formula C4H10O and a molecular weight of 78.09 g/mol. Its IUPAC name is (1,2,3,4-13C4)butan-1-ol.
| Compound Name | (1,2,3,4-13C4)butan-1-ol |
|---|---|
| PubChem CID | 71309697 |
| Molecular Formula | C4H10O |
| Molecular Weight | 78.09 g/mol |
| Exact Mass | 78.09 |
| IUPAC Name | (1,2,3,4-13C4)butan-1-ol |
| SMILES | [13CH3][13CH2][13CH2][13CH2]O |
| InChI | InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3/i1+1,2+1,3+1,4+1 |
| InChIKey | LRHPLDYGYMQRHN-JCDJMFQYSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 78.09 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |