About 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine
4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine (PubChem CID 71309698) has the molecular formula C6H9N3O2
and a molecular weight of 158.14 g/mol. Its IUPAC name is 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine.
Molecular Properties
| Compound Name | 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine |
| PubChem CID | 71309698 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 158.14 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine |
| SMILES | COc1cc(OC)[15n]c([15NH2])[15n]1 |
| InChI | InChI=1S/C6H9N3O2/c1-10-4-3-5(11-2)9-6(7)8-4/h3H,1-2H3,(H2,7,8,9)/i7+1,8+1,9+1 |
| InChIKey | LVFRCHIUUKWBLR-ULEDQSHZSA-N |
| XLogP | 0.08 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.14 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine?
The IUPAC name of 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine (CID 71309698) is 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine.
What is the SMILES notation for 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine?
The canonical SMILES for 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine is COc1cc(OC)[15n]c([15NH2])[15n]1.
What is the InChIKey of 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine?
The InChIKey is LVFRCHIUUKWBLR-ULEDQSHZSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-10-4-3-5(11-2)9-6(7)8-4/h3H,1-2H3,(H2,7,8,9)/i7+1,8+1,9+1.
What are the key properties of 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine?
4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine has a molecular weight of 158.14 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy(1,3-15N2)pyrimidin-2-(15N)amine is sourced from PubChem (CID 71309698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).