About 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine
2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine (PubChem CID 71309717) has the molecular formula C4HCl2FN2
and a molecular weight of 169.95 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine |
| PubChem CID | 71309717 |
| Molecular Formula | C4HCl2FN2 |
| Molecular Weight | 169.95 g/mol |
| Exact Mass | 168.95 |
| IUPAC Name | 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine |
| SMILES | Fc1c[15n][13c](Cl)[15n]c1Cl |
| InChI | InChI=1S/C4HCl2FN2/c5-3-2(7)1-8-4(6)9-3/h1H/i4+1,8+1,9+1 |
| InChIKey | WHPFEQUEHBULBW-WKPWXFLVSA-N |
| XLogP | 1.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.95 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine?
The IUPAC name of 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine (CID 71309717) is 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine.
What is the SMILES notation for 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine?
The canonical SMILES for 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine is Fc1c[15n][13c](Cl)[15n]c1Cl.
What is the InChIKey of 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine?
The InChIKey is WHPFEQUEHBULBW-WKPWXFLVSA-N. The full InChI is InChI=1S/C4HCl2FN2/c5-3-2(7)1-8-4(6)9-3/h1H/i4+1,8+1,9+1.
What are the key properties of 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine?
2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine has a molecular weight of 169.95 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-fluoro(213C,1,3-15N2)pyrimidine is sourced from PubChem (CID 71309717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).