C4H11N — CID 71309791
N-(1,2-13C2)ethyl(1,2-13C2)ethanamine (PubChem CID 71309791) has the molecular formula C4H11N and a molecular weight of 77.11 g/mol. Its IUPAC name is N-(1,2-13C2)ethyl(1,2-13C2)ethanamine.
| Compound Name | N-(1,2-13C2)ethyl(1,2-13C2)ethanamine |
|---|---|
| PubChem CID | 71309791 |
| Molecular Formula | C4H11N |
| Molecular Weight | 77.11 g/mol |
| Exact Mass | 77.10 |
| IUPAC Name | N-(1,2-13C2)ethyl(1,2-13C2)ethanamine |
| SMILES | [13CH3][13CH2]N[13CH2][13CH3] |
| InChI | InChI=1S/C4H11N/c1-3-5-4-2/h5H,3-4H2,1-2H3/i1+1,2+1,3+1,4+1 |
| InChIKey | HPNMFZURTQLUMO-JCDJMFQYSA-N |
| XLogP | 0.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 77.11 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |