C18H33KO2 — CID 71309848
potassium (E)-(1,2,3,7,8-13C5)octadec-9-enoate (PubChem CID 71309848) has the molecular formula C18H33KO2 and a molecular weight of 325.52 g/mol. Its IUPAC name is potassium (E)-(1,2,3,7,8-13C5)octadec-9-enoate.
| Compound Name | potassium (E)-(1,2,3,7,8-13C5)octadec-9-enoate |
|---|---|
| PubChem CID | 71309848 |
| Molecular Formula | C18H33KO2 |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | potassium (E)-(1,2,3,7,8-13C5)octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/[13CH2][13CH2]CCC[13CH2][13CH2][13C](=O)[O-].[K+] |
| InChI | InChI=1S/C18H34O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b10-9+;/i11+1,12+1,16+1,17+1,18+1; |
| InChIKey | MLICVSDCCDDWMD-JTXHVOEVSA-M |
| XLogP | 1.78 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|