About 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol
2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol (PubChem CID 71309853) has the molecular formula C8H19NO
and a molecular weight of 151.20 g/mol. Its IUPAC name is 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol |
| PubChem CID | 71309853 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 151.20 g/mol |
| Exact Mass | 151.17 |
| IUPAC Name | 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol |
| SMILES | [13CH3][13CH]([13CH3])N(CCO)[13CH]([13CH3])[13CH3] |
| InChI | InChI=1S/C8H19NO/c1-7(2)9(5-6-10)8(3)4/h7-8,10H,5-6H2,1-4H3/i1+1,2+1,3+1,4+1,7+1,8+1 |
| InChIKey | ZYWUVGFIXPNBDL-UQUYMPKGSA-N |
| XLogP | 1.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol?
The IUPAC name of 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol (CID 71309853) is 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol.
What is the SMILES notation for 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol?
The canonical SMILES for 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol is [13CH3][13CH]([13CH3])N(CCO)[13CH]([13CH3])[13CH3].
What is the InChIKey of 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol?
The InChIKey is ZYWUVGFIXPNBDL-UQUYMPKGSA-N. The full InChI is InChI=1S/C8H19NO/c1-7(2)9(5-6-10)8(3)4/h7-8,10H,5-6H2,1-4H3/i1+1,2+1,3+1,4+1,7+1,8+1.
What are the key properties of 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol?
2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol has a molecular weight of 151.20 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[di((1,2,3-13C3)propan-2-yl)amino]ethanol is sourced from PubChem (CID 71309853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).