C6H7NO2 — CID 71309877
1-(1,1,2,2,2-pentadeuterioethyl)pyrrole-2,5-dione (PubChem CID 71309877) has the molecular formula C6H7NO2 and a molecular weight of 130.16 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentadeuterioethyl)pyrrole-2,5-dione.
| Compound Name | 1-(1,1,2,2,2-pentadeuterioethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71309877 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 1-(1,1,2,2,2-pentadeuterioethyl)pyrrole-2,5-dione |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H7NO2/c1-2-7-5(8)3-4-6(7)9/h3-4H,2H2,1H3/i1D3,2D2 |
| InChIKey | HDFGOPSGAURCEO-ZBJDZAJPSA-N |
| XLogP | -0.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|