About bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine
bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine (PubChem CID 71310097) has the molecular formula H6Cl2N2
and a molecular weight of 111.00 g/mol. Its IUPAC name is bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine.
Molecular Properties
| Compound Name | bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine |
| PubChem CID | 71310097 |
| Molecular Formula | H6Cl2N2 |
| Molecular Weight | 111.00 g/mol |
| Exact Mass | 110.03 |
| IUPAC Name | bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine |
| SMILES | [2H]Cl.[2H]Cl.[2H]N([2H])N([2H])[2H] |
| InChI | InChI=1S/2ClH.H4N2/c;;1-2/h2*1H;1-2H2/i/hD6 |
| InChIKey | LIAWOTKNAVAKCX-YIKVAAQNSA-N |
| XLogP | -0.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.00 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine?
The IUPAC name of bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine (CID 71310097) is bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine.
What is the SMILES notation for bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine?
The canonical SMILES for bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine is [2H]Cl.[2H]Cl.[2H]N([2H])N([2H])[2H].
What is the InChIKey of bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine?
The InChIKey is LIAWOTKNAVAKCX-YIKVAAQNSA-N. The full InChI is InChI=1S/2ClH.H4N2/c;;1-2/h2*1H;1-2H2/i/hD6.
What are the key properties of bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine?
bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine has a molecular weight of 111.00 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2H)chlorane);1,1,2,2-tetradeuteriohydrazine is sourced from PubChem (CID 71310097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).