C6H10 — CID 71310103
1,1,4,4-tetradeuterio-2,3-bis(trideuteriomethyl)buta-1,3-diene (PubChem CID 71310103) has the molecular formula C6H10 and a molecular weight of 92.21 g/mol. Its IUPAC name is 1,1,4,4-tetradeuterio-2,3-bis(trideuteriomethyl)buta-1,3-diene.
| Compound Name | 1,1,4,4-tetradeuterio-2,3-bis(trideuteriomethyl)buta-1,3-diene |
|---|---|
| PubChem CID | 71310103 |
| Molecular Formula | C6H10 |
| Molecular Weight | 92.21 g/mol |
| Exact Mass | 92.14 |
| IUPAC Name | 1,1,4,4-tetradeuterio-2,3-bis(trideuteriomethyl)buta-1,3-diene |
| SMILES | [2H]C([2H])=C(C(=C([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3/i1D2,2D3,3D2,4D3 |
| InChIKey | SDJHPPZKZZWAKF-ZRKGKEHVSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|