About (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide
(2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide (PubChem CID 71310172) has the molecular formula C22H22BrO2P
and a molecular weight of 431.28 g/mol. Its IUPAC name is (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide |
| PubChem CID | 71310172 |
| Molecular Formula | C22H22BrO2P |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide |
| SMILES | CCO[13C](=O)[13CH2][P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H22O2P.BrH/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h3-17H,2,18H2,1H3;1H/q+1;/p-1/i18+1,22+1; |
| InChIKey | VJVZPTPOYCJFNI-WWPGYFPTSA-M |
| XLogP | 0.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide?
The IUPAC name of (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide (CID 71310172) is (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide.
What is the SMILES notation for (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide?
The canonical SMILES for (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide is CCO[13C](=O)[13CH2][P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide?
The InChIKey is VJVZPTPOYCJFNI-WWPGYFPTSA-M. The full InChI is InChI=1S/C22H22O2P.BrH/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h3-17H,2,18H2,1H3;1H/q+1;/p-1/i18+1,22+1;.
What are the key properties of (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide?
(2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide has a molecular weight of 431.28 g/mol, XLogP of 0.55, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide is sourced from PubChem (CID 71310172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).