About [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium
[(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium (PubChem CID 71310203) has the molecular formula C5H4F3O2Tl
and a molecular weight of 357.46 g/mol. Its IUPAC name is [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium.
Molecular Properties
| Compound Name | [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium |
| PubChem CID | 71310203 |
| Molecular Formula | C5H4F3O2Tl |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium |
| SMILES | C/C(=C\C(=O)C(F)(F)F)O[Tl] |
| InChI | InChI=1S/C5H5F3O2.Tl/c1-3(9)2-4(10)5(6,7)8;/h2,9H,1H3;/q;+1/p-1/b3-2+; |
| InChIKey | OIDHRVWTLISQKC-SQQVDAMQSA-M |
| XLogP | 1.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium?
The IUPAC name of [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium (CID 71310203) is [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium.
What is the SMILES notation for [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium?
The canonical SMILES for [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium is C/C(=C\C(=O)C(F)(F)F)O[Tl].
What is the InChIKey of [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium?
The InChIKey is OIDHRVWTLISQKC-SQQVDAMQSA-M. The full InChI is InChI=1S/C5H5F3O2.Tl/c1-3(9)2-4(10)5(6,7)8;/h2,9H,1H3;/q;+1/p-1/b3-2+;.
What are the key properties of [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium?
[(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium has a molecular weight of 357.46 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxythallium is sourced from PubChem (CID 71310203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).