C46H32F12FeP2 — CID 71310302
bis[3,5-bis(trifluoromethyl)phenyl]-[(1S)-1-[2-(2-diphenylphosphanylphenyl)cyclopenta-2,4-dien-1-yl]ethyl]phosphane;cyclopenta-1,3-diene;iron(2+) (PubChem CID 71310302) has the molecular formula C46H32F12FeP2 and a molecular weight of 930.53 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[(1S)-1-[2-(2-diphenylphosphanylphenyl)cyclopenta-2,4-dien-1-yl]ethyl]phosphane;cyclopenta-1,3-diene;iron(2+).
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[(1S)-1-[2-(2-diphenylphosphanylphenyl)cyclopenta-2,4-dien-1-yl]ethyl]phosphane;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 71310302 |
| Molecular Formula | C46H32F12FeP2 |
| Molecular Weight | 930.53 g/mol |
| Exact Mass | 930.11 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[(1S)-1-[2-(2-diphenylphosphanylphenyl)cyclopenta-2,4-dien-1-yl]ethyl]phosphane;cyclopenta-1,3-diene;iron(2+) |
| SMILES | C[C@@H]([c-]1cccc1-c1ccccc1P(c1ccccc1)c1ccccc1)P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C41H27F12P2.C5H5.Fe/c1-25(34-16-10-17-35(34)36-15-8-9-18-37(36)55(30-11-4-2-5-12-30)31-13-6-3-7-14-31)54(32-21-26(38(42,43)44)19-27(22-32)39(45,46)47)33-23-28(40(48,49)50)20-29(24-33)41(51,52)53;1-2-4-5-3-1;/h2-25H,1H3;1-5H;/q2*-1;+2/t25-;;/m0../s1 |
| InChIKey | FEDNCBFOAIDORO-WLOLSGMKSA-N |
| XLogP | 13.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.53 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|