C36H44FeP2 — CID 71310375
cyclopenta-1,3-diene;dicyclohexyl-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane;iron(2+) (PubChem CID 71310375) has the molecular formula C36H44FeP2 and a molecular weight of 594.54 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dicyclohexyl-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;dicyclohexyl-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane;iron(2+) |
|---|---|
| PubChem CID | 71310375 |
| Molecular Formula | C36H44FeP2 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | cyclopenta-1,3-diene;dicyclohexyl-[(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane;iron(2+) |
| SMILES | C[C@H]([c-]1cccc1P(c1ccccc1)c1ccccc1)P(C1CCCCC1)C1CCCCC1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C31H39P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h4-5,10-14,19-27H,2-3,6-9,15-18H2,1H3;1-5H;/q2*-1;+2/t25-;;/m1../s1 |
| InChIKey | REDWELITTWIEQG-KHZPMNTOSA-N |
| XLogP | 9.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|