C12H11BN2O4 — CID 71310576
2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile (PubChem CID 71310576) has the molecular formula C12H11BN2O4 and a molecular weight of 258.04 g/mol. Its IUPAC name is 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile.
| Compound Name | 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 71310576 |
| Molecular Formula | C12H11BN2O4 |
| Molecular Weight | 258.04 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile |
| SMILES | CN1CC(=O)OB(c2ccccc2C#N)OC(=O)C1 |
| InChI | InChI=1S/C12H11BN2O4/c1-15-7-11(16)18-13(19-12(17)8-15)10-5-3-2-4-9(10)6-14/h2-5H,7-8H2,1H3 |
| InChIKey | RBAKTQMELMUSRQ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.04 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|