C12H14BNO4 — CID 71310673
2-benzyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 71310673) has the molecular formula C12H14BNO4 and a molecular weight of 247.06 g/mol. Its IUPAC name is 2-benzyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-benzyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 71310673 |
| Molecular Formula | C12H14BNO4 |
| Molecular Weight | 247.06 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-benzyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(Cc2ccccc2)OC(=O)C1 |
| InChI | InChI=1S/C12H14BNO4/c1-14-8-11(15)17-13(18-12(16)9-14)7-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | JCSSTJJRXLARRP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.06 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|