C23H28BF4N3O — CID 71310800
(5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate (PubChem CID 71310800) has the molecular formula C23H28BF4N3O and a molecular weight of 449.30 g/mol. Its IUPAC name is (5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate.
| Compound Name | (5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate |
|---|---|
| PubChem CID | 71310800 |
| Molecular Formula | C23H28BF4N3O |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)COC(C)(C)[C@@H]3Cc2ccccc2)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C23H28N3O.BF4/c1-16-11-17(2)22(18(3)12-16)26-15-25-20(13-19-9-7-6-8-10-19)23(4,5)27-14-21(25)24-26;2-1(3,4)5/h6-12,15,20H,13-14H2,1-5H3;/q+1;-1/t20-;/m0./s1 |
| InChIKey | PVYSZYZMWZCJCT-BDQAORGHSA-N |
| XLogP | 5.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|