C23H28N3O+ — CID 71310801
(5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 71310801) has the molecular formula C23H28N3O+ and a molecular weight of 362.50 g/mol. Its IUPAC name is (5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | (5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 71310801 |
| Molecular Formula | C23H28N3O+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (5S)-5-benzyl-6,6-dimethyl-2-(2,4,6-trimethylphenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)COC(C)(C)[C@@H]3Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H28N3O/c1-16-11-17(2)22(18(3)12-16)26-15-25-20(13-19-9-7-6-8-10-19)23(4,5)27-14-21(25)24-26/h6-12,15,20H,13-14H2,1-5H3/q+1/t20-/m0/s1 |
| InChIKey | PEAPBLXOZOPHTK-FQEVSTJZSA-N |
| XLogP | 4.18 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|