About [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold
[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold (PubChem CID 71310802) has the molecular formula C21H24AuClN2
and a molecular weight of 536.86 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold.
Molecular Properties
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold |
| PubChem CID | 71310802 |
| Molecular Formula | C21H24AuClN2 |
| Molecular Weight | 536.86 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold |
| SMILES | Cc1cc(C)c(-n2ccn(-c3c(C)cc(C)cc3C)c2=[Au]Cl)c(C)c1 |
| InChI | InChI=1S/C21H24N2.Au.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;/h7-12H,1-6H3;;1H/q;+1;/p-1 |
| InChIKey | YFUIKJIITPMUAT-UHFFFAOYSA-M |
| XLogP | 5.89 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.86 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold?
The IUPAC name of [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold (CID 71310802) is [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold.
What is the SMILES notation for [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold?
The canonical SMILES for [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold is Cc1cc(C)c(-n2ccn(-c3c(C)cc(C)cc3C)c2=[Au]Cl)c(C)c1.
What is the InChIKey of [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold?
The InChIKey is YFUIKJIITPMUAT-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H24N2.Au.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;/h7-12H,1-6H3;;1H/q;+1;/p-1.
What are the key properties of [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold?
[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold has a molecular weight of 536.86 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold is sourced from PubChem (CID 71310802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).