About barium(2+);bis(2-methylpropan-2-olate)
barium(2+);bis(2-methylpropan-2-olate) (PubChem CID 71310859) has the molecular formula C8H18BaO2
and a molecular weight of 283.56 g/mol. Its IUPAC name is barium(2+);bis(2-methylpropan-2-olate).
Molecular Properties
| Compound Name | barium(2+);bis(2-methylpropan-2-olate) |
| PubChem CID | 71310859 |
| Molecular Formula | C8H18BaO2 |
| Molecular Weight | 283.56 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | barium(2+);bis(2-methylpropan-2-olate) |
| SMILES | CC(C)(C)[O-].CC(C)(C)[O-].[Ba+2] |
| InChI | InChI=1S/2C4H9O.Ba/c2*1-4(2,3)5;/h2*1-3H3;/q2*-1;+2 |
| InChIKey | SLPLCLDJTNLWPW-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.56 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze barium(2+);bis(2-methylpropan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-methylpropan-2-olate)?
The IUPAC name of barium(2+);bis(2-methylpropan-2-olate) (CID 71310859) is barium(2+);bis(2-methylpropan-2-olate).
What is the SMILES notation for barium(2+);bis(2-methylpropan-2-olate)?
The canonical SMILES for barium(2+);bis(2-methylpropan-2-olate) is CC(C)(C)[O-].CC(C)(C)[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(2-methylpropan-2-olate)?
The InChIKey is SLPLCLDJTNLWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9O.Ba/c2*1-4(2,3)5;/h2*1-3H3;/q2*-1;+2.
What are the key properties of barium(2+);bis(2-methylpropan-2-olate)?
barium(2+);bis(2-methylpropan-2-olate) has a molecular weight of 283.56 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-methylpropan-2-olate) is sourced from PubChem (CID 71310859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).