About (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride
(3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride (PubChem CID 71311034) has the molecular formula C8H18Cl2N2O2
and a molecular weight of 245.15 g/mol. Its IUPAC name is (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride |
| PubChem CID | 71311034 |
| Molecular Formula | C8H18Cl2N2O2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.O[C@H]1CNC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C8H16N2O2.2ClH/c11-8-6-9-5-7(8)10-1-3-12-4-2-10;;/h7-9,11H,1-6H2;2*1H/t7-,8-;;/m0../s1 |
| InChIKey | FYRDBEHYFIRUNY-FOMWZSOGSA-N |
| XLogP | -0.51 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride?
The IUPAC name of (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride (CID 71311034) is (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride.
What is the SMILES notation for (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride?
The canonical SMILES for (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride is Cl.Cl.O[C@H]1CNC[C@@H]1N1CCOCC1.
What is the InChIKey of (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride?
The InChIKey is FYRDBEHYFIRUNY-FOMWZSOGSA-N. The full InChI is InChI=1S/C8H16N2O2.2ClH/c11-8-6-9-5-7(8)10-1-3-12-4-2-10;;/h7-9,11H,1-6H2;2*1H/t7-,8-;;/m0../s1.
What are the key properties of (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride?
(3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride has a molecular weight of 245.15 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-morpholin-4-ylpyrrolidin-3-ol;dihydrochloride is sourced from PubChem (CID 71311034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).