About (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine
(1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine (PubChem CID 7131118) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine |
| PubChem CID | 7131118 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CN |
| InChI | InChI=1S/C13H17N3/c1-10-13(8-14)11(2)16(15-10)9-12-6-4-3-5-7-12/h3-7H,8-9,14H2,1-2H3 |
| InChIKey | LVFJOKRQRQBQAZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine?
The IUPAC name of (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine (CID 7131118) is (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine.
What is the SMILES notation for (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine?
The canonical SMILES for (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine is Cc1nn(Cc2ccccc2)c(C)c1CN.
What is the InChIKey of (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine?
The InChIKey is LVFJOKRQRQBQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-10-13(8-14)11(2)16(15-10)9-12-6-4-3-5-7-12/h3-7H,8-9,14H2,1-2H3.
What are the key properties of (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine?
(1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine has a molecular weight of 215.30 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-3,5-dimethylpyrazol-4-yl)methanamine is sourced from PubChem (CID 7131118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).