3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid

C6H8N2O2S — CID 7131140

IUPAC3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid
SMILESCNc1snc(C)c1C(=O)O
InChIInChI=1S/C6H8N2O2S/c1-3-4(6(9)10)5(7-2)11-8-3/h7H,1-2H3,(H,9,10)
InChIKeyCWFUERSVWFQTQD-UHFFFAOYSA-N
MW172.21 g/mol
LogP1.19
Rot. Bonds2

About 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid

3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid (PubChem CID 7131140) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid
PubChem CID7131140
Molecular FormulaC6H8N2O2S
Molecular Weight172.21 g/mol
Exact Mass172.03
IUPAC Name3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid
SMILESCNc1snc(C)c1C(=O)O
InChIInChI=1S/C6H8N2O2S/c1-3-4(6(9)10)5(7-2)11-8-3/h7H,1-2H3,(H,9,10)
InChIKeyCWFUERSVWFQTQD-UHFFFAOYSA-N
XLogP1.19
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 51.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid (CID 7131140) is 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid is CNc1snc(C)c1C(=O)O.
What is the InChIKey of 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid?
The InChIKey is CWFUERSVWFQTQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-3-4(6(9)10)5(7-2)11-8-3/h7H,1-2H3,(H,9,10).
What are the key properties of 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid?
3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid has a molecular weight of 172.21 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 7131140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).