C12H17F3N2O6 — CID 71311614
1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 71311614) has the molecular formula C12H17F3N2O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71311614 |
| Molecular Formula | C12H17F3N2O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | NCCOCCOCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H16N2O4.C2HF3O2/c11-3-5-15-7-8-16-6-4-12-9(13)1-2-10(12)14;3-2(4,5)1(6)7/h1-2H,3-8,11H2;(H,6,7) |
| InChIKey | WAOHORIEWBUISG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|