C25H21NO8S2 — CID 71311789
N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-4-methylsulfonylsulfanylbutanamide (PubChem CID 71311789) has the molecular formula C25H21NO8S2 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-4-methylsulfonylsulfanylbutanamide.
| Compound Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-4-methylsulfonylsulfanylbutanamide |
|---|---|
| PubChem CID | 71311789 |
| Molecular Formula | C25H21NO8S2 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-4-methylsulfonylsulfanylbutanamide |
| SMILES | CS(=O)(=O)SCCCC(=O)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C25H21NO8S2/c1-36(31,32)35-10-2-3-23(29)26-14-4-7-18-17(11-14)24(30)34-25(18)19-8-5-15(27)12-21(19)33-22-13-16(28)6-9-20(22)25/h4-9,11-13,27-28H,2-3,10H2,1H3,(H,26,29) |
| InChIKey | SWUYKQKSZGPAPW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|