About 3-ethoxypropylthiourea
3-ethoxypropylthiourea (PubChem CID 7131186) has the molecular formula C6H14N2OS
and a molecular weight of 162.26 g/mol. Its IUPAC name is 3-ethoxypropylthiourea.
Molecular Properties
| Compound Name | 3-ethoxypropylthiourea |
| PubChem CID | 7131186 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-ethoxypropylthiourea |
| SMILES | CCOCCCNC(N)=S |
| InChI | InChI=1S/C6H14N2OS/c1-2-9-5-3-4-8-6(7)10/h2-5H2,1H3,(H3,7,8,10) |
| InChIKey | BPIJXOIMSUEVHX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxypropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxypropylthiourea?
The IUPAC name of 3-ethoxypropylthiourea (CID 7131186) is 3-ethoxypropylthiourea.
What is the SMILES notation for 3-ethoxypropylthiourea?
The canonical SMILES for 3-ethoxypropylthiourea is CCOCCCNC(N)=S.
What is the InChIKey of 3-ethoxypropylthiourea?
The InChIKey is BPIJXOIMSUEVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS/c1-2-9-5-3-4-8-6(7)10/h2-5H2,1H3,(H3,7,8,10).
What are the key properties of 3-ethoxypropylthiourea?
3-ethoxypropylthiourea has a molecular weight of 162.26 g/mol, XLogP of 0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxypropylthiourea is sourced from PubChem (CID 7131186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).