About 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid
4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid (PubChem CID 7131217) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid |
| PubChem CID | 7131217 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1nc(-c2c[nH]c(C(=O)O)c2)cs1 |
| InChI | InChI=1S/C9H8N2O2S/c1-5-11-8(4-14-5)6-2-7(9(12)13)10-3-6/h2-4,10H,1H3,(H,12,13) |
| InChIKey | OHPWUXLRWDOXFY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid?
The IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid (CID 7131217) is 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid?
The canonical SMILES for 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid is Cc1nc(-c2c[nH]c(C(=O)O)c2)cs1.
What is the InChIKey of 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid?
The InChIKey is OHPWUXLRWDOXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-5-11-8(4-14-5)6-2-7(9(12)13)10-3-6/h2-4,10H,1H3,(H,12,13).
What are the key properties of 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid?
4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid has a molecular weight of 208.24 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 7131217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).