C15H14Cl3N5 — CID 71312426
1,2-bis[(E)-(4-chloro-2,3,5,6-tetradeuteriophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 71312426) has the molecular formula C15H14Cl3N5 and a molecular weight of 378.72 g/mol. Its IUPAC name is 1,2-bis[(E)-(4-chloro-2,3,5,6-tetradeuteriophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(E)-(4-chloro-2,3,5,6-tetradeuteriophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 71312426 |
| Molecular Formula | C15H14Cl3N5 |
| Molecular Weight | 378.72 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1,2-bis[(E)-(4-chloro-2,3,5,6-tetradeuteriophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.[2H]c1c([2H])c(/C=N/N=C(\N)N/N=C/c2c([2H])c([2H])c(Cl)c([2H])c2[2H])c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C15H13Cl2N5.ClH/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12;/h1-10H,(H3,18,21,22);1H/b19-9+,20-10+;/i1D,2D,3D,4D,5D,6D,7D,8D; |
| InChIKey | LTWIBTYLSRDGHP-YVXDQVGZSA-N |
| XLogP | 3.69 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|